C10H7FN2O2 — CID 171870269
2-(2-cyano-1,2-dihydroxyethyl)-5-fluorobenzonitrile (PubChem CID 171870269) has the molecular formula C10H7FN2O2 and a molecular weight of 206.18 g/mol. Its IUPAC name is 2-(2-cyano-1,2-dihydroxyethyl)-5-fluorobenzonitrile.
| Compound Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-fluorobenzonitrile |
|---|---|
| PubChem CID | 171870269 |
| Molecular Formula | C10H7FN2O2 |
| Molecular Weight | 206.18 g/mol |
| Exact Mass | 206.05 |
| IUPAC Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-fluorobenzonitrile |
| SMILES | N#Cc1cc(F)ccc1C(O)C(O)C#N |
| InChI | InChI=1S/C10H7FN2O2/c11-7-1-2-8(6(3-7)4-12)10(15)9(14)5-13/h1-3,9-10,14-15H |
| InChIKey | RAEYMPHTZCBLKQ-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 88.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|