C19H19FN2O4 — CID 171888464
benzyl N-[4-(2-cyano-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate (PubChem CID 171888464) has the molecular formula C19H19FN2O4 and a molecular weight of 358.37 g/mol. Its IUPAC name is benzyl N-[4-(2-cyano-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate.
| Compound Name | benzyl N-[4-(2-cyano-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
|---|---|
| PubChem CID | 171888464 |
| Molecular Formula | C19H19FN2O4 |
| Molecular Weight | 358.37 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | benzyl N-[4-(2-cyano-4-fluorophenyl)-3,4-dihydroxybutyl]carbamate |
| SMILES | N#Cc1cc(F)ccc1C(O)C(O)CCNC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C19H19FN2O4/c20-15-6-7-16(14(10-15)11-21)18(24)17(23)8-9-22-19(25)26-12-13-4-2-1-3-5-13/h1-7,10,17-18,23-24H,8-9,12H2,(H,22,25) |
| InChIKey | RTNWFQXMXNHWJP-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 102.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |