C19H20FNO6 — CID 171888707
2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-fluorobenzoic acid (PubChem CID 171888707) has the molecular formula C19H20FNO6 and a molecular weight of 377.37 g/mol. Its IUPAC name is 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-fluorobenzoic acid.
| Compound Name | 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-fluorobenzoic acid |
|---|---|
| PubChem CID | 171888707 |
| Molecular Formula | C19H20FNO6 |
| Molecular Weight | 377.37 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[1,2-dihydroxy-4-(phenylmethoxycarbonylamino)butyl]-5-fluorobenzoic acid |
| SMILES | O=C(NCCC(O)C(O)c1ccc(F)cc1C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C19H20FNO6/c20-13-6-7-14(15(10-13)18(24)25)17(23)16(22)8-9-21-19(26)27-11-12-4-2-1-3-5-12/h1-7,10,16-17,22-23H,8-9,11H2,(H,21,26)(H,24,25) |
| InChIKey | FJHCDDDRAXVWQM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.37 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |