C10H7N3O4 — CID 171870872
2-(2-cyano-1,2-dihydroxyethyl)-5-nitrobenzonitrile (PubChem CID 171870872) has the molecular formula C10H7N3O4 and a molecular weight of 233.18 g/mol. Its IUPAC name is 2-(2-cyano-1,2-dihydroxyethyl)-5-nitrobenzonitrile.
| Compound Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 171870872 |
| Molecular Formula | C10H7N3O4 |
| Molecular Weight | 233.18 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 2-(2-cyano-1,2-dihydroxyethyl)-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1C(O)C(O)C#N |
| InChI | InChI=1S/C10H7N3O4/c11-4-6-3-7(13(16)17)1-2-8(6)10(15)9(14)5-12/h1-3,9-10,14-15H |
| InChIKey | ZSQQLJXHGQCNGQ-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 131.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.18 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|