C15H10Br2N2O2 — CID 7159064
2-[(1S,2R)-1,2-dibromo-2-phenylethyl]-5-nitrobenzonitrile (PubChem CID 7159064) has the molecular formula C15H10Br2N2O2 and a molecular weight of 410.07 g/mol. Its IUPAC name is 2-[(1S,2R)-1,2-dibromo-2-phenylethyl]-5-nitrobenzonitrile.
| Compound Name | 2-[(1S,2R)-1,2-dibromo-2-phenylethyl]-5-nitrobenzonitrile |
|---|---|
| PubChem CID | 7159064 |
| Molecular Formula | C15H10Br2N2O2 |
| Molecular Weight | 410.07 g/mol |
| Exact Mass | 407.91 |
| IUPAC Name | 2-[(1S,2R)-1,2-dibromo-2-phenylethyl]-5-nitrobenzonitrile |
| SMILES | N#Cc1cc([N+](=O)[O-])ccc1[C@H](Br)[C@H](Br)c1ccccc1 |
| InChI | InChI=1S/C15H10Br2N2O2/c16-14(10-4-2-1-3-5-10)15(17)13-7-6-12(19(20)21)8-11(13)9-18/h1-8,14-15H/t14-,15+/m1/s1 |
| InChIKey | OSZGSUAGFFSIGF-CABCVRRESA-N |
| XLogP | 5.04 |
| TPSA | 66.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.07 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|