C11H16Cl2N2O2S — CID 105302110
[1-(2,5-dichlorophenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine (PubChem CID 105302110) has the molecular formula C11H16Cl2N2O2S and a molecular weight of 311.23 g/mol. Its IUPAC name is [1-(2,5-dichlorophenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(2,5-dichlorophenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 105302110 |
| Molecular Formula | C11H16Cl2N2O2S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.03 |
| IUPAC Name | [1-(2,5-dichlorophenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
| SMILES | CC(C)(C(NN)c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H16Cl2N2O2S/c1-11(2,18(3,16)17)10(15-14)8-6-7(12)4-5-9(8)13/h4-6,10,15H,14H2,1-3H3 |
| InChIKey | KCKRYHFLWKYKJL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|