C11H16ClFN2 — CID 105397762
[1-(2-chloro-5-fluorophenyl)-2,2-dimethylpropyl]hydrazine (PubChem CID 105397762) has the molecular formula C11H16ClFN2 and a molecular weight of 230.71 g/mol. Its IUPAC name is [1-(2-chloro-5-fluorophenyl)-2,2-dimethylpropyl]hydrazine.
| Compound Name | [1-(2-chloro-5-fluorophenyl)-2,2-dimethylpropyl]hydrazine |
|---|---|
| PubChem CID | 105397762 |
| Molecular Formula | C11H16ClFN2 |
| Molecular Weight | 230.71 g/mol |
| Exact Mass | 230.10 |
| IUPAC Name | [1-(2-chloro-5-fluorophenyl)-2,2-dimethylpropyl]hydrazine |
| SMILES | CC(C)(C)C(NN)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C11H16ClFN2/c1-11(2,3)10(15-14)8-6-7(13)4-5-9(8)12/h4-6,10,15H,14H2,1-3H3 |
| InChIKey | NVARRXMGRNIJHW-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.71 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|