C14H24N2O3S — CID 105333051
[1-(4-methoxy-2,5-dimethylphenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine (PubChem CID 105333051) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is [1-(4-methoxy-2,5-dimethylphenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine.
| Compound Name | [1-(4-methoxy-2,5-dimethylphenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
|---|---|
| PubChem CID | 105333051 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | [1-(4-methoxy-2,5-dimethylphenyl)-2-methyl-2-methylsulfonylpropyl]hydrazine |
| SMILES | COc1cc(C)c(C(NN)C(C)(C)S(C)(=O)=O)cc1C |
| InChI | InChI=1S/C14H24N2O3S/c1-9-8-12(19-5)10(2)7-11(9)13(16-15)14(3,4)20(6,17)18/h7-8,13,16H,15H2,1-6H3 |
| InChIKey | OKWQLNDAPOXMSW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|