C12H15F3O3S — CID 115795993
2-methyl-2-methylsulfonyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol (PubChem CID 115795993) has the molecular formula C12H15F3O3S and a molecular weight of 296.31 g/mol. Its IUPAC name is 2-methyl-2-methylsulfonyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol.
| Compound Name | 2-methyl-2-methylsulfonyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol |
|---|---|
| PubChem CID | 115795993 |
| Molecular Formula | C12H15F3O3S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | 2-methyl-2-methylsulfonyl-1-[2-(trifluoromethyl)phenyl]propan-1-ol |
| SMILES | CC(C)(C(O)c1ccccc1C(F)(F)F)S(C)(=O)=O |
| InChI | InChI=1S/C12H15F3O3S/c1-11(2,19(3,17)18)10(16)8-6-4-5-7-9(8)12(13,14)15/h4-7,10,16H,1-3H3 |
| InChIKey | FPPYCOAHYILXEF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |