C11H13F3O3S — CID 122475545
1-[2-(trifluoromethyl)phenyl]propyl methanesulfonate (PubChem CID 122475545) has the molecular formula C11H13F3O3S and a molecular weight of 282.28 g/mol. Its IUPAC name is 1-[2-(trifluoromethyl)phenyl]propyl methanesulfonate.
| Compound Name | 1-[2-(trifluoromethyl)phenyl]propyl methanesulfonate |
|---|---|
| PubChem CID | 122475545 |
| Molecular Formula | C11H13F3O3S |
| Molecular Weight | 282.28 g/mol |
| Exact Mass | 282.05 |
| IUPAC Name | 1-[2-(trifluoromethyl)phenyl]propyl methanesulfonate |
| SMILES | CCC(OS(C)(=O)=O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H13F3O3S/c1-3-10(17-18(2,15)16)8-6-4-5-7-9(8)11(12,13)14/h4-7,10H,3H2,1-2H3 |
| InChIKey | WHAANCUJTNAFKS-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|