C11H15F3N2O2S — CID 59536927
N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide (PubChem CID 59536927) has the molecular formula C11H15F3N2O2S and a molecular weight of 296.31 g/mol. Its IUPAC name is N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide.
| Compound Name | N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide |
|---|---|
| PubChem CID | 59536927 |
| Molecular Formula | C11H15F3N2O2S |
| Molecular Weight | 296.31 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | N-[2-amino-2-[2-(trifluoromethyl)phenyl]ethyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCC(N)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C11H15F3N2O2S/c1-2-19(17,18)16-7-10(15)8-5-3-4-6-9(8)11(12,13)14/h3-6,10,16H,2,7,15H2,1H3 |
| InChIKey | UUUDDABRWVFELP-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.31 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |