C14H19F3O2 — CID 116752097
2-ethoxy-2-methyl-1-[2-(trifluoromethyl)phenyl]butan-1-ol (PubChem CID 116752097) has the molecular formula C14H19F3O2 and a molecular weight of 276.30 g/mol. Its IUPAC name is 2-ethoxy-2-methyl-1-[2-(trifluoromethyl)phenyl]butan-1-ol.
| Compound Name | 2-ethoxy-2-methyl-1-[2-(trifluoromethyl)phenyl]butan-1-ol |
|---|---|
| PubChem CID | 116752097 |
| Molecular Formula | C14H19F3O2 |
| Molecular Weight | 276.30 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-ethoxy-2-methyl-1-[2-(trifluoromethyl)phenyl]butan-1-ol |
| SMILES | CCOC(C)(CC)C(O)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H19F3O2/c1-4-13(3,19-5-2)12(18)10-8-6-7-9-11(10)14(15,16)17/h6-9,12,18H,4-5H2,1-3H3 |
| InChIKey | PNXIHNHTSHZFRJ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.30 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |