C10H7ClF6 — CID 79730978
1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-difluoro-5-methylbenzene (PubChem CID 79730978) has the molecular formula C10H7ClF6 and a molecular weight of 276.61 g/mol. Its IUPAC name is 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 79730978 |
| Molecular Formula | C10H7ClF6 |
| Molecular Weight | 276.61 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | 1-(1-chloro-2,2,3,3-tetrafluoropropyl)-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Cl)C(F)(F)C(F)F)c(F)cc1F |
| InChI | InChI=1S/C10H7ClF6/c1-4-2-5(7(13)3-6(4)12)8(11)10(16,17)9(14)15/h2-3,8-9H,1H3 |
| InChIKey | QWMNLELXUIKKLG-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.61 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|