C11H7BrF8 — CID 103310756
1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,4-difluoro-5-methylbenzene (PubChem CID 103310756) has the molecular formula C11H7BrF8 and a molecular weight of 371.07 g/mol. Its IUPAC name is 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 103310756 |
| Molecular Formula | C11H7BrF8 |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 369.96 |
| IUPAC Name | 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Br)C(C(F)(F)F)C(F)(F)F)c(F)cc1F |
| InChI | InChI=1S/C11H7BrF8/c1-4-2-5(7(14)3-6(4)13)8(12)9(10(15,16)17)11(18,19)20/h2-3,8-9H,1H3 |
| InChIKey | SNQOVNWTXNEMLA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|