C12H11BrF6O — CID 103310697
1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-methoxy-2-methylbenzene (PubChem CID 103310697) has the molecular formula C12H11BrF6O and a molecular weight of 365.11 g/mol. Its IUPAC name is 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-methoxy-2-methylbenzene.
| Compound Name | 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-methoxy-2-methylbenzene |
|---|---|
| PubChem CID | 103310697 |
| Molecular Formula | C12H11BrF6O |
| Molecular Weight | 365.11 g/mol |
| Exact Mass | 363.99 |
| IUPAC Name | 1-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-methoxy-2-methylbenzene |
| SMILES | COc1ccc(C(Br)C(C(F)(F)F)C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C12H11BrF6O/c1-6-5-7(20-2)3-4-8(6)9(13)10(11(14,15)16)12(17,18)19/h3-5,9-10H,1-2H3 |
| InChIKey | KZEWIGOXIQEJCN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.11 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|