C11H8BrF7O — CID 103310717
2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-fluoro-1-methoxybenzene (PubChem CID 103310717) has the molecular formula C11H8BrF7O and a molecular weight of 369.07 g/mol. Its IUPAC name is 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-fluoro-1-methoxybenzene.
| Compound Name | 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-fluoro-1-methoxybenzene |
|---|---|
| PubChem CID | 103310717 |
| Molecular Formula | C11H8BrF7O |
| Molecular Weight | 369.07 g/mol |
| Exact Mass | 367.96 |
| IUPAC Name | 2-[1-bromo-3,3,3-trifluoro-2-(trifluoromethyl)propyl]-4-fluoro-1-methoxybenzene |
| SMILES | COc1ccc(F)cc1C(Br)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C11H8BrF7O/c1-20-7-3-2-5(13)4-6(7)8(12)9(10(14,15)16)11(17,18)19/h2-4,8-9H,1H3 |
| InChIKey | QSGWMOAVHLZJDV-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.07 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|