C12H8Br2F2O — CID 79731362
2-bromo-5-[bromo-(2,4-difluoro-5-methylphenyl)methyl]furan (PubChem CID 79731362) has the molecular formula C12H8Br2F2O and a molecular weight of 366.00 g/mol. Its IUPAC name is 2-bromo-5-[bromo-(2,4-difluoro-5-methylphenyl)methyl]furan.
| Compound Name | 2-bromo-5-[bromo-(2,4-difluoro-5-methylphenyl)methyl]furan |
|---|---|
| PubChem CID | 79731362 |
| Molecular Formula | C12H8Br2F2O |
| Molecular Weight | 366.00 g/mol |
| Exact Mass | 363.89 |
| IUPAC Name | 2-bromo-5-[bromo-(2,4-difluoro-5-methylphenyl)methyl]furan |
| SMILES | Cc1cc(C(Br)c2ccc(Br)o2)c(F)cc1F |
| InChI | InChI=1S/C12H8Br2F2O/c1-6-4-7(9(16)5-8(6)15)12(14)10-2-3-11(13)17-10/h2-5,12H,1H3 |
| InChIKey | SWGUHEKHJUKNEK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.00 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|