C16H11BrF2S — CID 79731199
3-[bromo-(2,4-difluoro-5-methylphenyl)methyl]-1-benzothiophene (PubChem CID 79731199) has the molecular formula C16H11BrF2S and a molecular weight of 353.23 g/mol. Its IUPAC name is 3-[bromo-(2,4-difluoro-5-methylphenyl)methyl]-1-benzothiophene.
| Compound Name | 3-[bromo-(2,4-difluoro-5-methylphenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 79731199 |
| Molecular Formula | C16H11BrF2S |
| Molecular Weight | 353.23 g/mol |
| Exact Mass | 351.97 |
| IUPAC Name | 3-[bromo-(2,4-difluoro-5-methylphenyl)methyl]-1-benzothiophene |
| SMILES | Cc1cc(C(Br)c2csc3ccccc23)c(F)cc1F |
| InChI | InChI=1S/C16H11BrF2S/c1-9-6-11(14(19)7-13(9)18)16(17)12-8-20-15-5-3-2-4-10(12)15/h2-8,16H,1H3 |
| InChIKey | DCECWJAZJJUDQI-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.23 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|