C15H9BrF2S — CID 63440195
3-[bromo-(3,4-difluorophenyl)methyl]-1-benzothiophene (PubChem CID 63440195) has the molecular formula C15H9BrF2S and a molecular weight of 339.20 g/mol. Its IUPAC name is 3-[bromo-(3,4-difluorophenyl)methyl]-1-benzothiophene.
| Compound Name | 3-[bromo-(3,4-difluorophenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 63440195 |
| Molecular Formula | C15H9BrF2S |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 337.96 |
| IUPAC Name | 3-[bromo-(3,4-difluorophenyl)methyl]-1-benzothiophene |
| SMILES | Fc1ccc(C(Br)c2csc3ccccc23)cc1F |
| InChI | InChI=1S/C15H9BrF2S/c16-15(9-5-6-12(17)13(18)7-9)11-8-19-14-4-2-1-3-10(11)14/h1-8,15H |
| InChIKey | DRRLCWBEJJQYKW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|