C17H15BrS — CID 63437623
3-[bromo-(2,4-dimethylphenyl)methyl]-1-benzothiophene (PubChem CID 63437623) has the molecular formula C17H15BrS and a molecular weight of 331.28 g/mol. Its IUPAC name is 3-[bromo-(2,4-dimethylphenyl)methyl]-1-benzothiophene.
| Compound Name | 3-[bromo-(2,4-dimethylphenyl)methyl]-1-benzothiophene |
|---|---|
| PubChem CID | 63437623 |
| Molecular Formula | C17H15BrS |
| Molecular Weight | 331.28 g/mol |
| Exact Mass | 330.01 |
| IUPAC Name | 3-[bromo-(2,4-dimethylphenyl)methyl]-1-benzothiophene |
| SMILES | Cc1ccc(C(Br)c2csc3ccccc23)c(C)c1 |
| InChI | InChI=1S/C17H15BrS/c1-11-7-8-13(12(2)9-11)17(18)15-10-19-16-6-4-3-5-14(15)16/h3-10,17H,1-2H3 |
| InChIKey | YHEYWOISDNDRBB-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.28 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|