C18H19NS — CID 104990399
1-benzothiophen-3-yl-(2,4,5-trimethylphenyl)methanamine (PubChem CID 104990399) has the molecular formula C18H19NS and a molecular weight of 281.42 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(2,4,5-trimethylphenyl)methanamine.
| Compound Name | 1-benzothiophen-3-yl-(2,4,5-trimethylphenyl)methanamine |
|---|---|
| PubChem CID | 104990399 |
| Molecular Formula | C18H19NS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | 1-benzothiophen-3-yl-(2,4,5-trimethylphenyl)methanamine |
| SMILES | Cc1cc(C)c(C(N)c2csc3ccccc23)cc1C |
| InChI | InChI=1S/C18H19NS/c1-11-8-13(3)15(9-12(11)2)18(19)16-10-20-17-7-5-4-6-14(16)17/h4-10,18H,19H2,1-3H3 |
| InChIKey | MANUXPJHVZWQFB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |