C15H11F2NS — CID 43150877
1-benzothiophen-3-yl-(2,6-difluorophenyl)methanamine (PubChem CID 43150877) has the molecular formula C15H11F2NS and a molecular weight of 275.32 g/mol. Its IUPAC name is 1-benzothiophen-3-yl-(2,6-difluorophenyl)methanamine.
| Compound Name | 1-benzothiophen-3-yl-(2,6-difluorophenyl)methanamine |
|---|---|
| PubChem CID | 43150877 |
| Molecular Formula | C15H11F2NS |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.06 |
| IUPAC Name | 1-benzothiophen-3-yl-(2,6-difluorophenyl)methanamine |
| SMILES | NC(c1c(F)cccc1F)c1csc2ccccc12 |
| InChI | InChI=1S/C15H11F2NS/c16-11-5-3-6-12(17)14(11)15(18)10-8-19-13-7-2-1-4-9(10)13/h1-8,15H,18H2 |
| InChIKey | UMTSIXGUCWZKNY-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |