C14H10Cl2F2 — CID 79731389
1-[chloro-(3-chlorophenyl)methyl]-2,4-difluoro-5-methylbenzene (PubChem CID 79731389) has the molecular formula C14H10Cl2F2 and a molecular weight of 287.14 g/mol. Its IUPAC name is 1-[chloro-(3-chlorophenyl)methyl]-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-[chloro-(3-chlorophenyl)methyl]-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 79731389 |
| Molecular Formula | C14H10Cl2F2 |
| Molecular Weight | 287.14 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 1-[chloro-(3-chlorophenyl)methyl]-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Cl)c2cccc(Cl)c2)c(F)cc1F |
| InChI | InChI=1S/C14H10Cl2F2/c1-8-5-11(13(18)7-12(8)17)14(16)9-3-2-4-10(15)6-9/h2-7,14H,1H3 |
| InChIKey | IAYZABVWOIERTQ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.14 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|