C13H8Cl4 — CID 63436332
1,4-dichloro-2-[chloro-(3-chlorophenyl)methyl]benzene (PubChem CID 63436332) has the molecular formula C13H8Cl4 and a molecular weight of 306.02 g/mol. Its IUPAC name is 1,4-dichloro-2-[chloro-(3-chlorophenyl)methyl]benzene.
| Compound Name | 1,4-dichloro-2-[chloro-(3-chlorophenyl)methyl]benzene |
|---|---|
| PubChem CID | 63436332 |
| Molecular Formula | C13H8Cl4 |
| Molecular Weight | 306.02 g/mol |
| Exact Mass | 303.94 |
| IUPAC Name | 1,4-dichloro-2-[chloro-(3-chlorophenyl)methyl]benzene |
| SMILES | Clc1cccc(C(Cl)c2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C13H8Cl4/c14-9-3-1-2-8(6-9)13(17)11-7-10(15)4-5-12(11)16/h1-7,13H |
| InChIKey | IZSUTYGBUGDRKH-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.02 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|