C16H21ClF2 — CID 79730355
1-(1-chloro-3-cyclohexylpropyl)-2,4-difluoro-5-methylbenzene (PubChem CID 79730355) has the molecular formula C16H21ClF2 and a molecular weight of 286.79 g/mol. Its IUPAC name is 1-(1-chloro-3-cyclohexylpropyl)-2,4-difluoro-5-methylbenzene.
| Compound Name | 1-(1-chloro-3-cyclohexylpropyl)-2,4-difluoro-5-methylbenzene |
|---|---|
| PubChem CID | 79730355 |
| Molecular Formula | C16H21ClF2 |
| Molecular Weight | 286.79 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 1-(1-chloro-3-cyclohexylpropyl)-2,4-difluoro-5-methylbenzene |
| SMILES | Cc1cc(C(Cl)CCC2CCCCC2)c(F)cc1F |
| InChI | InChI=1S/C16H21ClF2/c1-11-9-13(16(19)10-15(11)18)14(17)8-7-12-5-3-2-4-6-12/h9-10,12,14H,2-8H2,1H3 |
| InChIKey | NZBHSIFIPXSNFI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.79 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|