C11H14F2O — CID 20684551
1-(2,5-dimethylphenyl)-2,2-difluoropropan-1-ol (PubChem CID 20684551) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-2,2-difluoropropan-1-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-2,2-difluoropropan-1-ol |
|---|---|
| PubChem CID | 20684551 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-2,2-difluoropropan-1-ol |
| SMILES | Cc1ccc(C)c(C(O)C(C)(F)F)c1 |
| InChI | InChI=1S/C11H14F2O/c1-7-4-5-8(2)9(6-7)10(14)11(3,12)13/h4-6,10,14H,1-3H3 |
| InChIKey | LKROAZXVUWSLHW-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |