C15H24O — CID 65148482
1-(2,5-dimethylphenyl)-4,4-dimethylpentan-1-ol (PubChem CID 65148482) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(2,5-dimethylphenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 65148482 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4,4-dimethylpentan-1-ol |
| SMILES | Cc1ccc(C)c(C(O)CCC(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O/c1-11-6-7-12(2)13(10-11)14(16)8-9-15(3,4)5/h6-7,10,14,16H,8-9H2,1-5H3 |
| InChIKey | LITWSTCUEYSXRQ-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |