C14H23NO — CID 62774526
2-(tert-butylamino)-1-(2,5-dimethylphenyl)ethanol (PubChem CID 62774526) has the molecular formula C14H23NO and a molecular weight of 221.34 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(2,5-dimethylphenyl)ethanol.
| Compound Name | 2-(tert-butylamino)-1-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 62774526 |
| Molecular Formula | C14H23NO |
| Molecular Weight | 221.34 g/mol |
| Exact Mass | 221.18 |
| IUPAC Name | 2-(tert-butylamino)-1-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(C(O)CNC(C)(C)C)c1 |
| InChI | InChI=1S/C14H23NO/c1-10-6-7-11(2)12(8-10)13(16)9-15-14(3,4)5/h6-8,13,15-16H,9H2,1-5H3 |
| InChIKey | LUMVQSBAHXMUFE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |