C11H14F2O — CID 84669441
1-[2-(1,1-difluoroethyl)-5-methylphenyl]ethanol (PubChem CID 84669441) has the molecular formula C11H14F2O and a molecular weight of 200.23 g/mol. Its IUPAC name is 1-[2-(1,1-difluoroethyl)-5-methylphenyl]ethanol.
| Compound Name | 1-[2-(1,1-difluoroethyl)-5-methylphenyl]ethanol |
|---|---|
| PubChem CID | 84669441 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-[2-(1,1-difluoroethyl)-5-methylphenyl]ethanol |
| SMILES | Cc1ccc(C(C)(F)F)c(C(C)O)c1 |
| InChI | InChI=1S/C11H14F2O/c1-7-4-5-10(11(3,12)13)9(6-7)8(2)14/h4-6,8,14H,1-3H3 |
| InChIKey | FCBVRSRUAXYOJM-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |