C12H15F3O2 — CID 64565484
1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]ethanol (PubChem CID 64565484) has the molecular formula C12H15F3O2 and a molecular weight of 248.24 g/mol. Its IUPAC name is 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]ethanol.
| Compound Name | 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 64565484 |
| Molecular Formula | C12H15F3O2 |
| Molecular Weight | 248.24 g/mol |
| Exact Mass | 248.10 |
| IUPAC Name | 1-[5-methyl-2-(3,3,3-trifluoropropoxy)phenyl]ethanol |
| SMILES | Cc1ccc(OCCC(F)(F)F)c(C(C)O)c1 |
| InChI | InChI=1S/C12H15F3O2/c1-8-3-4-11(10(7-8)9(2)16)17-6-5-12(13,14)15/h3-4,7,9,16H,5-6H2,1-2H3 |
| InChIKey | RGESYKGHXKCSEO-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.24 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |