C9H8F4O — CID 62962605
2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)ethanol (PubChem CID 62962605) has the molecular formula C9H8F4O and a molecular weight of 208.15 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)ethanol.
| Compound Name | 2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)ethanol |
|---|---|
| PubChem CID | 62962605 |
| Molecular Formula | C9H8F4O |
| Molecular Weight | 208.15 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | 2,2,2-trifluoro-1-(2-fluoro-5-methylphenyl)ethanol |
| SMILES | Cc1ccc(F)c(C(O)C(F)(F)F)c1 |
| InChI | InChI=1S/C9H8F4O/c1-5-2-3-7(10)6(4-5)8(14)9(11,12)13/h2-4,8,14H,1H3 |
| InChIKey | OEPUBQPURMRAEF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.15 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |