C14H10F4O — CID 62509973
(2-fluoro-5-methylphenyl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 62509973) has the molecular formula C14H10F4O and a molecular weight of 270.23 g/mol. Its IUPAC name is (2-fluoro-5-methylphenyl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (2-fluoro-5-methylphenyl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 62509973 |
| Molecular Formula | C14H10F4O |
| Molecular Weight | 270.23 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | (2-fluoro-5-methylphenyl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | Cc1ccc(F)c(C(O)c2c(F)cc(F)cc2F)c1 |
| InChI | InChI=1S/C14H10F4O/c1-7-2-3-10(16)9(4-7)14(19)13-11(17)5-8(15)6-12(13)18/h2-6,14,19H,1H3 |
| InChIKey | YRBCIHYCIBLSFC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |