C13H6F6O — CID 103303216
(2,4,5-trifluorophenyl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 103303216) has the molecular formula C13H6F6O and a molecular weight of 292.18 g/mol. Its IUPAC name is (2,4,5-trifluorophenyl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (2,4,5-trifluorophenyl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 103303216 |
| Molecular Formula | C13H6F6O |
| Molecular Weight | 292.18 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (2,4,5-trifluorophenyl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(F)cc1F)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H6F6O/c14-5-1-10(18)12(11(19)2-5)13(20)6-3-8(16)9(17)4-7(6)15/h1-4,13,20H |
| InChIKey | NZOFEZIAHWEVSW-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.18 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|