C13H7ClF4O — CID 61089185
(2-chloro-4-fluorophenyl)-(2,4,6-trifluorophenyl)methanol (PubChem CID 61089185) has the molecular formula C13H7ClF4O and a molecular weight of 290.64 g/mol. Its IUPAC name is (2-chloro-4-fluorophenyl)-(2,4,6-trifluorophenyl)methanol.
| Compound Name | (2-chloro-4-fluorophenyl)-(2,4,6-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 61089185 |
| Molecular Formula | C13H7ClF4O |
| Molecular Weight | 290.64 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | (2-chloro-4-fluorophenyl)-(2,4,6-trifluorophenyl)methanol |
| SMILES | OC(c1ccc(F)cc1Cl)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H7ClF4O/c14-9-3-6(15)1-2-8(9)13(19)12-10(17)4-7(16)5-11(12)18/h1-5,13,19H |
| InChIKey | NFYGVNPSCXIXNN-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.64 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |