C9H9F3O — CID 61087665
1-(2,4,6-trifluorophenyl)propan-1-ol (PubChem CID 61087665) has the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)propan-1-ol.
| Compound Name | 1-(2,4,6-trifluorophenyl)propan-1-ol |
|---|---|
| PubChem CID | 61087665 |
| Molecular Formula | C9H9F3O |
| Molecular Weight | 190.16 g/mol |
| Exact Mass | 190.06 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)propan-1-ol |
| SMILES | CCC(O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C9H9F3O/c1-2-8(13)9-6(11)3-5(10)4-7(9)12/h3-4,8,13H,2H2,1H3 |
| InChIKey | CHRHZJPSOQHYSZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.16 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |