C10H11F3O3 — CID 171872119
1-(2,4,6-trifluorophenyl)butane-1,2,4-triol (PubChem CID 171872119) has the molecular formula C10H11F3O3 and a molecular weight of 236.19 g/mol. Its IUPAC name is 1-(2,4,6-trifluorophenyl)butane-1,2,4-triol.
| Compound Name | 1-(2,4,6-trifluorophenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872119 |
| Molecular Formula | C10H11F3O3 |
| Molecular Weight | 236.19 g/mol |
| Exact Mass | 236.07 |
| IUPAC Name | 1-(2,4,6-trifluorophenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C10H11F3O3/c11-5-3-6(12)9(7(13)4-5)10(16)8(15)1-2-14/h3-4,8,10,14-16H,1-2H2 |
| InChIKey | RZTPYKMIQNWZPF-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.19 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |