C10H12ClFO4 — CID 171872255
1-(3-chloro-5-fluoro-2-hydroxyphenyl)butane-1,2,4-triol (PubChem CID 171872255) has the molecular formula C10H12ClFO4 and a molecular weight of 250.65 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2-hydroxyphenyl)butane-1,2,4-triol.
| Compound Name | 1-(3-chloro-5-fluoro-2-hydroxyphenyl)butane-1,2,4-triol |
|---|---|
| PubChem CID | 171872255 |
| Molecular Formula | C10H12ClFO4 |
| Molecular Weight | 250.65 g/mol |
| Exact Mass | 250.04 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2-hydroxyphenyl)butane-1,2,4-triol |
| SMILES | OCCC(O)C(O)c1cc(F)cc(Cl)c1O |
| InChI | InChI=1S/C10H12ClFO4/c11-7-4-5(12)3-6(9(7)15)10(16)8(14)1-2-13/h3-4,8,10,13-16H,1-2H2 |
| InChIKey | TUWIYOYOZQTMEU-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.65 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |