C10H11Cl2FO2S — CID 171873906
1-(2,6-dichloro-4-fluorophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171873906) has the molecular formula C10H11Cl2FO2S and a molecular weight of 285.17 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-fluorophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2,6-dichloro-4-fluorophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171873906 |
| Molecular Formula | C10H11Cl2FO2S |
| Molecular Weight | 285.17 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 1-(2,6-dichloro-4-fluorophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | OC(CCS)C(O)c1c(Cl)cc(F)cc1Cl |
| InChI | InChI=1S/C10H11Cl2FO2S/c11-6-3-5(13)4-7(12)9(6)10(15)8(14)1-2-16/h3-4,8,10,14-16H,1-2H2 |
| InChIKey | CFOSGSDEQXRDIQ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.17 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|