C10H9F5O2S — CID 171874607
1-(2,3,4,5,6-pentafluorophenyl)-4-sulfanylbutane-1,2-diol (PubChem CID 171874607) has the molecular formula C10H9F5O2S and a molecular weight of 288.24 g/mol. Its IUPAC name is 1-(2,3,4,5,6-pentafluorophenyl)-4-sulfanylbutane-1,2-diol.
| Compound Name | 1-(2,3,4,5,6-pentafluorophenyl)-4-sulfanylbutane-1,2-diol |
|---|---|
| PubChem CID | 171874607 |
| Molecular Formula | C10H9F5O2S |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.02 |
| IUPAC Name | 1-(2,3,4,5,6-pentafluorophenyl)-4-sulfanylbutane-1,2-diol |
| SMILES | OC(CCS)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H9F5O2S/c11-5-4(10(17)3(16)1-2-18)6(12)8(14)9(15)7(5)13/h3,10,16-18H,1-2H2 |
| InChIKey | ZHSQINAYYHEBLU-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|