C12H13F5O — CID 107894708
2-methyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol (PubChem CID 107894708) has the molecular formula C12H13F5O and a molecular weight of 268.22 g/mol. Its IUPAC name is 2-methyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol.
| Compound Name | 2-methyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol |
|---|---|
| PubChem CID | 107894708 |
| Molecular Formula | C12H13F5O |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 2-methyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol |
| SMILES | CCCC(C)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5O/c1-3-4-5(2)12(18)6-7(13)9(15)11(17)10(16)8(6)14/h5,12,18H,3-4H2,1-2H3 |
| InChIKey | OBVDROGUPGCIPM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|