C12H13F5O2 — CID 115836119
4-methoxy-2-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol (PubChem CID 115836119) has the molecular formula C12H13F5O2 and a molecular weight of 284.22 g/mol. Its IUPAC name is 4-methoxy-2-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol.
| Compound Name | 4-methoxy-2-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 115836119 |
| Molecular Formula | C12H13F5O2 |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 4-methoxy-2-methyl-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
| SMILES | COCCC(C)C(O)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H13F5O2/c1-5(3-4-19-2)12(18)6-7(13)9(15)11(17)10(16)8(6)14/h5,12,18H,3-4H2,1-2H3 |
| InChIKey | GHGBEVQSMCXXME-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|