About ethane;1-methoxy-3-methylbutane
ethane;1-methoxy-3-methylbutane (PubChem CID 144580604) has the molecular formula C10H26O
and a molecular weight of 162.32 g/mol. Its IUPAC name is ethane;1-methoxy-3-methylbutane.
Molecular Properties
| Compound Name | ethane;1-methoxy-3-methylbutane |
| PubChem CID | 144580604 |
| Molecular Formula | C10H26O |
| Molecular Weight | 162.32 g/mol |
| Exact Mass | 162.20 |
| IUPAC Name | ethane;1-methoxy-3-methylbutane |
| SMILES | CC.CC.COCCC(C)C |
| InChI | InChI=1S/C6H14O.2C2H6/c1-6(2)4-5-7-3;2*1-2/h6H,4-5H2,1-3H3;2*1-2H3 |
| InChIKey | QJRJHHOHKUWJLT-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.32 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-methoxy-3-methylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methoxy-3-methylbutane?
The IUPAC name of ethane;1-methoxy-3-methylbutane (CID 144580604) is ethane;1-methoxy-3-methylbutane.
What is the SMILES notation for ethane;1-methoxy-3-methylbutane?
The canonical SMILES for ethane;1-methoxy-3-methylbutane is CC.CC.COCCC(C)C.
What is the InChIKey of ethane;1-methoxy-3-methylbutane?
The InChIKey is QJRJHHOHKUWJLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O.2C2H6/c1-6(2)4-5-7-3;2*1-2/h6H,4-5H2,1-3H3;2*1-2H3.
What are the key properties of ethane;1-methoxy-3-methylbutane?
ethane;1-methoxy-3-methylbutane has a molecular weight of 162.32 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methoxy-3-methylbutane is sourced from PubChem (CID 144580604), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).