C12H29NO — CID 144662875
ethane;5-methoxy-N,N,2,3-tetramethylpentan-1-amine (PubChem CID 144662875) has the molecular formula C12H29NO and a molecular weight of 203.37 g/mol. Its IUPAC name is ethane;5-methoxy-N,N,2,3-tetramethylpentan-1-amine.
| Compound Name | ethane;5-methoxy-N,N,2,3-tetramethylpentan-1-amine |
|---|---|
| PubChem CID | 144662875 |
| Molecular Formula | C12H29NO |
| Molecular Weight | 203.37 g/mol |
| Exact Mass | 203.22 |
| IUPAC Name | ethane;5-methoxy-N,N,2,3-tetramethylpentan-1-amine |
| SMILES | CC.COCCC(C)C(C)CN(C)C |
| InChI | InChI=1S/C10H23NO.C2H6/c1-9(6-7-12-5)10(2)8-11(3)4;1-2/h9-10H,6-8H2,1-5H3;1-2H3 |
| InChIKey | LHCZHEIRGGGMOR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |