C9H21NO — CID 163903931
(2R,3R)-4-methoxy-N,N,2,3-tetramethylbutan-1-amine (PubChem CID 163903931) has the molecular formula C9H21NO and a molecular weight of 159.27 g/mol. Its IUPAC name is (2R,3R)-4-methoxy-N,N,2,3-tetramethylbutan-1-amine.
| Compound Name | (2R,3R)-4-methoxy-N,N,2,3-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 163903931 |
| Molecular Formula | C9H21NO |
| Molecular Weight | 159.27 g/mol |
| Exact Mass | 159.16 |
| IUPAC Name | (2R,3R)-4-methoxy-N,N,2,3-tetramethylbutan-1-amine |
| SMILES | COC[C@H](C)[C@@H](C)CN(C)C |
| InChI | InChI=1S/C9H21NO/c1-8(6-10(3)4)9(2)7-11-5/h8-9H,6-7H2,1-5H3/t8-,9-/m0/s1 |
| InChIKey | QMGIEAQLWKZGGL-IUCAKERBSA-N |
| XLogP | 1.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |