C9H20O3 — CID 59866935
1,4-dimethoxy-2-(methoxymethyl)-3-methylbutane (PubChem CID 59866935) has the molecular formula C9H20O3 and a molecular weight of 176.26 g/mol. Its IUPAC name is 1,4-dimethoxy-2-(methoxymethyl)-3-methylbutane.
| Compound Name | 1,4-dimethoxy-2-(methoxymethyl)-3-methylbutane |
|---|---|
| PubChem CID | 59866935 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | 1,4-dimethoxy-2-(methoxymethyl)-3-methylbutane |
| SMILES | COCC(C)C(COC)COC |
| InChI | InChI=1S/C9H20O3/c1-8(5-10-2)9(6-11-3)7-12-4/h8-9H,5-7H2,1-4H3 |
| InChIKey | VVHIUKOVJSCFSQ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |