C10H22O — CID 121338192
(3S)-3-(methoxymethyl)-2,5-dimethylhexane (PubChem CID 121338192) has the molecular formula C10H22O and a molecular weight of 158.28 g/mol. Its IUPAC name is (3S)-3-(methoxymethyl)-2,5-dimethylhexane.
| Compound Name | (3S)-3-(methoxymethyl)-2,5-dimethylhexane |
|---|---|
| PubChem CID | 121338192 |
| Molecular Formula | C10H22O |
| Molecular Weight | 158.28 g/mol |
| Exact Mass | 158.17 |
| IUPAC Name | (3S)-3-(methoxymethyl)-2,5-dimethylhexane |
| SMILES | COC[C@@H](CC(C)C)C(C)C |
| InChI | InChI=1S/C10H22O/c1-8(2)6-10(7-11-5)9(3)4/h8-10H,6-7H2,1-5H3/t10-/m1/s1 |
| InChIKey | HBYATWUQDMVDPS-SNVBAGLBSA-N |
| XLogP | 2.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.28 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |