About 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane
1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane (PubChem CID 170161342) has the molecular formula C13H30O3
and a molecular weight of 234.38 g/mol. Its IUPAC name is 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane.
Molecular Properties
| Compound Name | 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane |
| PubChem CID | 170161342 |
| Molecular Formula | C13H30O3 |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.22 |
| IUPAC Name | 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane |
| SMILES | COC(C)C.COCC(COC)CC(C)C |
| InChI | InChI=1S/C9H20O2.C4H10O/c1-8(2)5-9(6-10-3)7-11-4;1-4(2)5-3/h8-9H,5-7H2,1-4H3;4H,1-3H3 |
| InChIKey | XAAVIFIYOWONKB-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane?
The IUPAC name of 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane (CID 170161342) is 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane.
What is the SMILES notation for 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane?
The canonical SMILES for 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane is COC(C)C.COCC(COC)CC(C)C.
What is the InChIKey of 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane?
The InChIKey is XAAVIFIYOWONKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2.C4H10O/c1-8(2)5-9(6-10-3)7-11-4;1-4(2)5-3/h8-9H,5-7H2,1-4H3;4H,1-3H3.
What are the key properties of 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane?
1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane has a molecular weight of 234.38 g/mol, XLogP of 2.98, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxy-2-(methoxymethyl)-4-methylpentane;2-methoxypropane is sourced from PubChem (CID 170161342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).