About CID 88668128
CID 88668128 (PubChem CID 88668128) has the molecular formula C16H34MgO
and a molecular weight of 266.75 g/mol.
Molecular Properties
| Compound Name | CID 88668128 |
| PubChem CID | 88668128 |
| Molecular Formula | C16H34MgO |
| Molecular Weight | 266.75 g/mol |
| Exact Mass | 266.25 |
| IUPAC Name | — |
| SMILES | CCC(COCC(CC)CC(C)C)CC(C)C.[Mg] |
| InChI | InChI=1S/C16H34O.Mg/c1-7-15(9-13(3)4)11-17-12-16(8-2)10-14(5)6;/h13-16H,7-12H2,1-6H3; |
| InChIKey | YWKYTLQSIWRHFF-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze CID 88668128 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 88668128?
The IUPAC name of CID 88668128 (CID 88668128) is not available.
What is the SMILES notation for CID 88668128?
The canonical SMILES for CID 88668128 is CCC(COCC(CC)CC(C)C)CC(C)C.[Mg].
What is the InChIKey of CID 88668128?
The InChIKey is YWKYTLQSIWRHFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34O.Mg/c1-7-15(9-13(3)4)11-17-12-16(8-2)10-14(5)6;/h13-16H,7-12H2,1-6H3;.
What are the key properties of CID 88668128?
CID 88668128 has a molecular weight of 266.75 g/mol, XLogP of 4.77, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 88668128 is sourced from PubChem (CID 88668128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).