C10H23NO2 — CID 116502132
4-amino-1-methoxy-2,6-dimethylheptan-3-ol (PubChem CID 116502132) has the molecular formula C10H23NO2 and a molecular weight of 189.30 g/mol. Its IUPAC name is 4-amino-1-methoxy-2,6-dimethylheptan-3-ol.
| Compound Name | 4-amino-1-methoxy-2,6-dimethylheptan-3-ol |
|---|---|
| PubChem CID | 116502132 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | 4-amino-1-methoxy-2,6-dimethylheptan-3-ol |
| SMILES | COCC(C)C(O)C(N)CC(C)C |
| InChI | InChI=1S/C10H23NO2/c1-7(2)5-9(11)10(12)8(3)6-13-4/h7-10,12H,5-6,11H2,1-4H3 |
| InChIKey | NIZYWALAFBGEOZ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |