About 1-methoxypropan-2-ol chloride
1-methoxypropan-2-ol chloride (PubChem CID 23303898) has the molecular formula C4H10ClO2-
and a molecular weight of 125.57 g/mol. Its IUPAC name is 1-methoxypropan-2-ol chloride.
Molecular Properties
| Compound Name | 1-methoxypropan-2-ol chloride |
| PubChem CID | 23303898 |
| Molecular Formula | C4H10ClO2- |
| Molecular Weight | 125.57 g/mol |
| Exact Mass | 125.04 |
| IUPAC Name | 1-methoxypropan-2-ol chloride |
| SMILES | COCC(C)O.[Cl-] |
| InChI | InChI=1S/C4H10O2.ClH/c1-4(5)3-6-2;/h4-5H,3H2,1-2H3;1H/p-1 |
| InChIKey | MMHWFKUQERZGQQ-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.57 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methoxypropan-2-ol chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methoxypropan-2-ol chloride?
The IUPAC name of 1-methoxypropan-2-ol chloride (CID 23303898) is 1-methoxypropan-2-ol chloride.
What is the SMILES notation for 1-methoxypropan-2-ol chloride?
The canonical SMILES for 1-methoxypropan-2-ol chloride is COCC(C)O.[Cl-].
What is the InChIKey of 1-methoxypropan-2-ol chloride?
The InChIKey is MMHWFKUQERZGQQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O2.ClH/c1-4(5)3-6-2;/h4-5H,3H2,1-2H3;1H/p-1.
What are the key properties of 1-methoxypropan-2-ol chloride?
1-methoxypropan-2-ol chloride has a molecular weight of 125.57 g/mol, XLogP of -2.98, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methoxypropan-2-ol chloride is sourced from PubChem (CID 23303898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).